C19H18N2O4 — CID 87001795
N-[2-methoxy-5-(methylcarbamoyl)phenyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 87001795) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is N-[2-methoxy-5-(methylcarbamoyl)phenyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-methoxy-5-(methylcarbamoyl)phenyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 87001795 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-[2-methoxy-5-(methylcarbamoyl)phenyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | CNC(=O)c1ccc(OC)c(NC(=O)c2oc3ccccc3c2C)c1 |
| InChI | InChI=1S/C19H18N2O4/c1-11-13-6-4-5-7-15(13)25-17(11)19(23)21-14-10-12(18(22)20-2)8-9-16(14)24-3/h4-10H,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | FVJITXQZUIMTCH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |