C17H33N3O — CID 87005504
1-cyclopropyl-1-(3-methylbutyl)-3-[2-(4-methylpiperidin-1-yl)ethyl]urea (PubChem CID 87005504) has the molecular formula C17H33N3O and a molecular weight of 295.47 g/mol. Its IUPAC name is 1-cyclopropyl-1-(3-methylbutyl)-3-[2-(4-methylpiperidin-1-yl)ethyl]urea.
| Compound Name | 1-cyclopropyl-1-(3-methylbutyl)-3-[2-(4-methylpiperidin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 87005504 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | 1-cyclopropyl-1-(3-methylbutyl)-3-[2-(4-methylpiperidin-1-yl)ethyl]urea |
| SMILES | CC(C)CCN(C(=O)NCCN1CCC(C)CC1)C1CC1 |
| InChI | InChI=1S/C17H33N3O/c1-14(2)6-12-20(16-4-5-16)17(21)18-9-13-19-10-7-15(3)8-11-19/h14-16H,4-13H2,1-3H3,(H,18,21) |
| InChIKey | HMICRSSOIUTYGT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |