C22H18N2O3S2 — CID 87005592
N-[2-(1-benzothiophen-3-yl)ethyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide (PubChem CID 87005592) has the molecular formula C22H18N2O3S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)ethyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)ethyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide |
|---|---|
| PubChem CID | 87005592 |
| Molecular Formula | C22H18N2O3S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)ethyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide |
| SMILES | O=C(CN1c2cccc3cccc(c23)S1(=O)=O)NCCc1csc2ccccc12 |
| InChI | InChI=1S/C22H18N2O3S2/c25-21(23-12-11-16-14-28-19-9-2-1-7-17(16)19)13-24-18-8-3-5-15-6-4-10-20(22(15)18)29(24,26)27/h1-10,14H,11-13H2,(H,23,25) |
| InChIKey | WTVNHAJFYAXPSE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |