C17H24N4OS — CID 87009120
1,1-bis(2-methylpropyl)-3-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea (PubChem CID 87009120) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 1,1-bis(2-methylpropyl)-3-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea.
| Compound Name | 1,1-bis(2-methylpropyl)-3-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 87009120 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1,1-bis(2-methylpropyl)-3-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea |
| SMILES | CC(C)CN(CC(C)C)C(=O)Nc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C17H24N4OS/c1-12(2)9-21(10-13(3)4)17(22)20-16-19-15(11-23-16)14-6-5-7-18-8-14/h5-8,11-13H,9-10H2,1-4H3,(H,19,20,22) |
| InChIKey | SODWRPJJAFVDAK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |