C17H24N4O2S — CID 111450162
1-(2-hydroxy-2,5-dimethylhexyl)-3-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea (PubChem CID 111450162) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-(2-hydroxy-2,5-dimethylhexyl)-3-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(2-hydroxy-2,5-dimethylhexyl)-3-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 111450162 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-(2-hydroxy-2,5-dimethylhexyl)-3-(4-pyridin-3-yl-1,3-thiazol-2-yl)urea |
| SMILES | CC(C)CCC(C)(O)CNC(=O)Nc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C17H24N4O2S/c1-12(2)6-7-17(3,23)11-19-15(22)21-16-20-14(10-24-16)13-5-4-8-18-9-13/h4-5,8-10,12,23H,6-7,11H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | QWVGSOHMWSRGBE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |