C18H30N4O3S — CID 87010050
N-[[4-(dimethylamino)phenyl]methyl]-2-[2-(methanesulfonamido)ethyl]piperidine-1-carboxamide (PubChem CID 87010050) has the molecular formula C18H30N4O3S and a molecular weight of 382.53 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-[2-(methanesulfonamido)ethyl]piperidine-1-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[2-(methanesulfonamido)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 87010050 |
| Molecular Formula | C18H30N4O3S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[2-(methanesulfonamido)ethyl]piperidine-1-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)N2CCCCC2CCNS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H30N4O3S/c1-21(2)16-9-7-15(8-10-16)14-19-18(23)22-13-5-4-6-17(22)11-12-20-26(3,24)25/h7-10,17,20H,4-6,11-14H2,1-3H3,(H,19,23) |
| InChIKey | OQIGFVNLVUPUMN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|