C12H20N4O3S — CID 92634332
N-[2-[(2S)-1-(1H-pyrazole-5-carbonyl)piperidin-2-yl]ethyl]methanesulfonamide (PubChem CID 92634332) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[2-[(2S)-1-(1H-pyrazole-5-carbonyl)piperidin-2-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(2S)-1-(1H-pyrazole-5-carbonyl)piperidin-2-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 92634332 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[2-[(2S)-1-(1H-pyrazole-5-carbonyl)piperidin-2-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC[C@@H]1CCCCN1C(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C12H20N4O3S/c1-20(18,19)14-8-5-10-4-2-3-9-16(10)12(17)11-6-7-13-15-11/h6-7,10,14H,2-5,8-9H2,1H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | KMLDJLCOZNNADF-JTQLQIEISA-N |
| XLogP | 0.34 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |