C16H26N2O3S2 — CID 87047179
N-[2-[1-(4-ethyl-5-methylthiophene-2-carbonyl)piperidin-2-yl]ethyl]methanesulfonamide (PubChem CID 87047179) has the molecular formula C16H26N2O3S2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-[2-[1-(4-ethyl-5-methylthiophene-2-carbonyl)piperidin-2-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[1-(4-ethyl-5-methylthiophene-2-carbonyl)piperidin-2-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 87047179 |
| Molecular Formula | C16H26N2O3S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-[2-[1-(4-ethyl-5-methylthiophene-2-carbonyl)piperidin-2-yl]ethyl]methanesulfonamide |
| SMILES | CCc1cc(C(=O)N2CCCCC2CCNS(C)(=O)=O)sc1C |
| InChI | InChI=1S/C16H26N2O3S2/c1-4-13-11-15(22-12(13)2)16(19)18-10-6-5-7-14(18)8-9-17-23(3,20)21/h11,14,17H,4-10H2,1-3H3 |
| InChIKey | RIMRDUQVZRONII-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |