C16H23FN2O3S2 — CID 87009534
N-[2-[1-[2-(4-fluorophenyl)sulfanylacetyl]piperidin-2-yl]ethyl]methanesulfonamide (PubChem CID 87009534) has the molecular formula C16H23FN2O3S2 and a molecular weight of 374.50 g/mol. Its IUPAC name is N-[2-[1-[2-(4-fluorophenyl)sulfanylacetyl]piperidin-2-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[1-[2-(4-fluorophenyl)sulfanylacetyl]piperidin-2-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 87009534 |
| Molecular Formula | C16H23FN2O3S2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-[2-[1-[2-(4-fluorophenyl)sulfanylacetyl]piperidin-2-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCC1CCCCN1C(=O)CSc1ccc(F)cc1 |
| InChI | InChI=1S/C16H23FN2O3S2/c1-24(21,22)18-10-9-14-4-2-3-11-19(14)16(20)12-23-15-7-5-13(17)6-8-15/h5-8,14,18H,2-4,9-12H2,1H3 |
| InChIKey | QRIWLROZUJLFQT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |