C16H23N5O3S — CID 92634296
N-[2-[(2S)-1-[2-(benzotriazol-1-yl)acetyl]piperidin-2-yl]ethyl]methanesulfonamide (PubChem CID 92634296) has the molecular formula C16H23N5O3S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[2-[(2S)-1-[2-(benzotriazol-1-yl)acetyl]piperidin-2-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(2S)-1-[2-(benzotriazol-1-yl)acetyl]piperidin-2-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 92634296 |
| Molecular Formula | C16H23N5O3S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-[2-[(2S)-1-[2-(benzotriazol-1-yl)acetyl]piperidin-2-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC[C@@H]1CCCCN1C(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C16H23N5O3S/c1-25(23,24)17-10-9-13-6-4-5-11-20(13)16(22)12-21-15-8-3-2-7-14(15)18-19-21/h2-3,7-8,13,17H,4-6,9-12H2,1H3/t13-/m0/s1 |
| InChIKey | AHGUEZWEDZSQGV-ZDUSSCGKSA-N |
| XLogP | 0.75 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |