C19H27N5O3S — CID 92632422
2-(benzotriazol-1-yl)-1-[4-[(2S)-1-methylsulfonylpiperidin-2-yl]piperidin-1-yl]ethanone (PubChem CID 92632422) has the molecular formula C19H27N5O3S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-1-[4-[(2S)-1-methylsulfonylpiperidin-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-(benzotriazol-1-yl)-1-[4-[(2S)-1-methylsulfonylpiperidin-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 92632422 |
| Molecular Formula | C19H27N5O3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-(benzotriazol-1-yl)-1-[4-[(2S)-1-methylsulfonylpiperidin-2-yl]piperidin-1-yl]ethanone |
| SMILES | CS(=O)(=O)N1CCCC[C@H]1C1CCN(C(=O)Cn2nnc3ccccc32)CC1 |
| InChI | InChI=1S/C19H27N5O3S/c1-28(26,27)24-11-5-4-7-17(24)15-9-12-22(13-10-15)19(25)14-23-18-8-3-2-6-16(18)20-21-23/h2-3,6,8,15,17H,4-5,7,9-14H2,1H3/t17-/m0/s1 |
| InChIKey | MUWYZAOHRZDOPA-KRWDZBQOSA-N |
| XLogP | 1.48 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |