C12H16N4O2S — CID 95833627
1-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]benzotriazole (PubChem CID 95833627) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 1-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]benzotriazole.
| Compound Name | 1-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]benzotriazole |
|---|---|
| PubChem CID | 95833627 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]benzotriazole |
| SMILES | CS(=O)(=O)N1CCC[C@@H]1Cn1nnc2ccccc21 |
| InChI | InChI=1S/C12H16N4O2S/c1-19(17,18)16-8-4-5-10(16)9-15-12-7-3-2-6-11(12)13-14-15/h2-3,6-7,10H,4-5,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | PUVPHTMYGXHJSC-SNVBAGLBSA-N |
| XLogP | 0.86 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |