C17H31N3O3S — CID 119727534
N-[2-[1-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]piperidin-2-yl]ethyl]methanesulfonamide (PubChem CID 119727534) has the molecular formula C17H31N3O3S and a molecular weight of 357.52 g/mol. Its IUPAC name is N-[2-[1-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]piperidin-2-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[1-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]piperidin-2-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 119727534 |
| Molecular Formula | C17H31N3O3S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-[2-[1-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]piperidin-2-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCC1CCCCN1C(=O)CC1CC2CCC(C1)N2 |
| InChI | InChI=1S/C17H31N3O3S/c1-24(22,23)18-8-7-16-4-2-3-9-20(16)17(21)12-13-10-14-5-6-15(11-13)19-14/h13-16,18-19H,2-12H2,1H3 |
| InChIKey | RLPNOMKKHBPNEG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |