C19H22F2N2O4 — CID 87010141
1-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-[3-(2-methoxyethoxy)phenyl]urea (PubChem CID 87010141) has the molecular formula C19H22F2N2O4 and a molecular weight of 380.39 g/mol. Its IUPAC name is 1-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-[3-(2-methoxyethoxy)phenyl]urea.
| Compound Name | 1-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-[3-(2-methoxyethoxy)phenyl]urea |
|---|---|
| PubChem CID | 87010141 |
| Molecular Formula | C19H22F2N2O4 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-[3-(2-methoxyethoxy)phenyl]urea |
| SMILES | COCCOc1cccc(NC(=O)NC(C)c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C19H22F2N2O4/c1-13(14-6-8-16(9-7-14)27-18(20)21)22-19(24)23-15-4-3-5-17(12-15)26-11-10-25-2/h3-9,12-13,18H,10-11H2,1-2H3,(H2,22,23,24) |
| InChIKey | NVPYSQXTHCEDJY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|