C17H14F2N4O2 — CID 87010883
N-[[2-(difluoromethoxy)phenyl]methyl]-2-imidazol-1-ylpyridine-4-carboxamide (PubChem CID 87010883) has the molecular formula C17H14F2N4O2 and a molecular weight of 344.32 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-2-imidazol-1-ylpyridine-4-carboxamide.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-imidazol-1-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 87010883 |
| Molecular Formula | C17H14F2N4O2 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-imidazol-1-ylpyridine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1OC(F)F)c1ccnc(-n2ccnc2)c1 |
| InChI | InChI=1S/C17H14F2N4O2/c18-17(19)25-14-4-2-1-3-13(14)10-22-16(24)12-5-6-21-15(9-12)23-8-7-20-11-23/h1-9,11,17H,10H2,(H,22,24) |
| InChIKey | ZDBHOBLDURCAFN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |