C17H18FNO4S — CID 87012644
3-(4-fluorophenyl)-N-(4-methoxyphenyl)sulfonyl-N-methylpropanamide (PubChem CID 87012644) has the molecular formula C17H18FNO4S and a molecular weight of 351.40 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(4-methoxyphenyl)sulfonyl-N-methylpropanamide.
| Compound Name | 3-(4-fluorophenyl)-N-(4-methoxyphenyl)sulfonyl-N-methylpropanamide |
|---|---|
| PubChem CID | 87012644 |
| Molecular Formula | C17H18FNO4S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(4-methoxyphenyl)sulfonyl-N-methylpropanamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)C(=O)CCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H18FNO4S/c1-19(17(20)12-5-13-3-6-14(18)7-4-13)24(21,22)16-10-8-15(23-2)9-11-16/h3-4,6-11H,5,12H2,1-2H3 |
| InChIKey | HRXOZKXNGFPTJN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |