C19H22N6O2 — CID 87013100
1,3-dimethyl-5-[[4-(2-nitrophenyl)piperazin-1-yl]methyl]pyrazolo[5,4-b]pyridine (PubChem CID 87013100) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 1,3-dimethyl-5-[[4-(2-nitrophenyl)piperazin-1-yl]methyl]pyrazolo[5,4-b]pyridine.
| Compound Name | 1,3-dimethyl-5-[[4-(2-nitrophenyl)piperazin-1-yl]methyl]pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 87013100 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 1,3-dimethyl-5-[[4-(2-nitrophenyl)piperazin-1-yl]methyl]pyrazolo[5,4-b]pyridine |
| SMILES | Cc1nn(C)c2ncc(CN3CCN(c4ccccc4[N+](=O)[O-])CC3)cc12 |
| InChI | InChI=1S/C19H22N6O2/c1-14-16-11-15(12-20-19(16)22(2)21-14)13-23-7-9-24(10-8-23)17-5-3-4-6-18(17)25(26)27/h3-6,11-12H,7-10,13H2,1-2H3 |
| InChIKey | RORPVBRAPLMFFZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|