C18H20N6O3S — CID 87017002
[4-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]piperazin-1-yl]-(5-nitrothiophen-2-yl)methanone (PubChem CID 87017002) has the molecular formula C18H20N6O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is [4-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]piperazin-1-yl]-(5-nitrothiophen-2-yl)methanone.
| Compound Name | [4-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]piperazin-1-yl]-(5-nitrothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 87017002 |
| Molecular Formula | C18H20N6O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [4-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]piperazin-1-yl]-(5-nitrothiophen-2-yl)methanone |
| SMILES | Cc1nn(C)c2ncc(CN3CCN(C(=O)c4ccc([N+](=O)[O-])s4)CC3)cc12 |
| InChI | InChI=1S/C18H20N6O3S/c1-12-14-9-13(10-19-17(14)21(2)20-12)11-22-5-7-23(8-6-22)18(25)15-3-4-16(28-15)24(26)27/h3-4,9-10H,5-8,11H2,1-2H3 |
| InChIKey | BQWRJXRFIOWASC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|