C19H29FN2O3S — CID 87013763
2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[(4-fluorophenyl)methyl]-N-pentylacetamide (PubChem CID 87013763) has the molecular formula C19H29FN2O3S and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[(4-fluorophenyl)methyl]-N-pentylacetamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[(4-fluorophenyl)methyl]-N-pentylacetamide |
|---|---|
| PubChem CID | 87013763 |
| Molecular Formula | C19H29FN2O3S |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[(4-fluorophenyl)methyl]-N-pentylacetamide |
| SMILES | CCCCCN(Cc1ccc(F)cc1)C(=O)CN(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H29FN2O3S/c1-3-4-5-11-22(13-16-6-8-17(20)9-7-16)19(23)14-21(2)18-10-12-26(24,25)15-18/h6-9,18H,3-5,10-15H2,1-2H3 |
| InChIKey | VFMDTHOTFUXEJK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|