C20H18ClN5 — CID 87014827
2-[4-(7-chloroquinazolin-4-yl)-1,4-diazepan-1-yl]benzonitrile (PubChem CID 87014827) has the molecular formula C20H18ClN5 and a molecular weight of 363.85 g/mol. Its IUPAC name is 2-[4-(7-chloroquinazolin-4-yl)-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 2-[4-(7-chloroquinazolin-4-yl)-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 87014827 |
| Molecular Formula | C20H18ClN5 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-[4-(7-chloroquinazolin-4-yl)-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccccc1N1CCCN(c2ncnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C20H18ClN5/c21-16-6-7-17-18(12-16)23-14-24-20(17)26-9-3-8-25(10-11-26)19-5-2-1-4-15(19)13-22/h1-2,4-7,12,14H,3,8-11H2 |
| InChIKey | SQUIMUKRJQQSKR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |