C18H20ClN5O2 — CID 86860791
1-[2-[4-(7-chloroquinazolin-4-yl)piperazin-1-yl]ethyl]pyrrolidine-2,5-dione (PubChem CID 86860791) has the molecular formula C18H20ClN5O2 and a molecular weight of 373.84 g/mol. Its IUPAC name is 1-[2-[4-(7-chloroquinazolin-4-yl)piperazin-1-yl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[4-(7-chloroquinazolin-4-yl)piperazin-1-yl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 86860791 |
| Molecular Formula | C18H20ClN5O2 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-[2-[4-(7-chloroquinazolin-4-yl)piperazin-1-yl]ethyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CCN1CCN(c2ncnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C18H20ClN5O2/c19-13-1-2-14-15(11-13)20-12-21-18(14)23-8-5-22(6-9-23)7-10-24-16(25)3-4-17(24)26/h1-2,11-12H,3-10H2 |
| InChIKey | JNJSUSPGTISDRR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|