C19H21ClN2O4 — CID 87016388
1-(4-chlorophenyl)-N-[3-(furan-2-ylmethoxy)propyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 87016388) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[3-(furan-2-ylmethoxy)propyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[3-(furan-2-ylmethoxy)propyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 87016388 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[3-(furan-2-ylmethoxy)propyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCOCc1ccco1)C1CC(=O)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H21ClN2O4/c20-15-4-6-16(7-5-15)22-12-14(11-18(22)23)19(24)21-8-2-9-25-13-17-3-1-10-26-17/h1,3-7,10,14H,2,8-9,11-13H2,(H,21,24) |
| InChIKey | IETGSIAXJQWLAG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|