C19H29N3O2S — CID 87022176
N-ethyl-N-(2-methylprop-2-enyl)-2-[4-(thiophene-3-carbonyl)-1,4-diazepan-1-yl]propanamide (PubChem CID 87022176) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is N-ethyl-N-(2-methylprop-2-enyl)-2-[4-(thiophene-3-carbonyl)-1,4-diazepan-1-yl]propanamide.
| Compound Name | N-ethyl-N-(2-methylprop-2-enyl)-2-[4-(thiophene-3-carbonyl)-1,4-diazepan-1-yl]propanamide |
|---|---|
| PubChem CID | 87022176 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-ethyl-N-(2-methylprop-2-enyl)-2-[4-(thiophene-3-carbonyl)-1,4-diazepan-1-yl]propanamide |
| SMILES | C=C(C)CN(CC)C(=O)C(C)N1CCCN(C(=O)c2ccsc2)CC1 |
| InChI | InChI=1S/C19H29N3O2S/c1-5-20(13-15(2)3)18(23)16(4)21-8-6-9-22(11-10-21)19(24)17-7-12-25-14-17/h7,12,14,16H,2,5-6,8-11,13H2,1,3-4H3 |
| InChIKey | OLKWGJHQEKSUAD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|