C16H13Cl2FN2O — CID 87025666
(2,6-dichloro-4-pyridinyl)-(8-fluoro-6-methyl-3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 87025666) has the molecular formula C16H13Cl2FN2O and a molecular weight of 339.20 g/mol. Its IUPAC name is (2,6-dichloro-4-pyridinyl)-(8-fluoro-6-methyl-3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | (2,6-dichloro-4-pyridinyl)-(8-fluoro-6-methyl-3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 87025666 |
| Molecular Formula | C16H13Cl2FN2O |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | (2,6-dichloro-4-pyridinyl)-(8-fluoro-6-methyl-3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | Cc1cc(F)c2c(c1)CCCN2C(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2FN2O/c1-9-5-10-3-2-4-21(15(10)12(19)6-9)16(22)11-7-13(17)20-14(18)8-11/h5-8H,2-4H2,1H3 |
| InChIKey | WRDADLBKHYAUEV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|