C15H20N4O4 — CID 87038599
1-[2-(furan-2-yl)-2-hydroxyethyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea (PubChem CID 87038599) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-hydroxyethyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea.
| Compound Name | 1-[2-(furan-2-yl)-2-hydroxyethyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 87038599 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-hydroxyethyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea |
| SMILES | O=C(NCC(O)c1ccco1)Nc1cnn(CC2CCCO2)c1 |
| InChI | InChI=1S/C15H20N4O4/c20-13(14-4-2-6-23-14)8-16-15(21)18-11-7-17-19(9-11)10-12-3-1-5-22-12/h2,4,6-7,9,12-13,20H,1,3,5,8,10H2,(H2,16,18,21) |
| InChIKey | DMVLAWWURWUVTE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |