C17H22N4O3 — CID 87039947
2-(4-ethylpiperazin-1-yl)-2-oxo-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide (PubChem CID 87039947) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-2-oxo-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-2-oxo-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide |
|---|---|
| PubChem CID | 87039947 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-2-oxo-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide |
| SMILES | CCN1CCN(C(=O)C(=O)Nc2ccc3c(c2)CCC(=O)N3)CC1 |
| InChI | InChI=1S/C17H22N4O3/c1-2-20-7-9-21(10-8-20)17(24)16(23)18-13-4-5-14-12(11-13)3-6-15(22)19-14/h4-5,11H,2-3,6-10H2,1H3,(H,18,23)(H,19,22) |
| InChIKey | LOLWWNMMQGJYOS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|