C30H39N3O5 — CID 87049200
(5R,7S)-3-cycloheptyl-2-N-cyclohexyl-6-N-(3-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87049200) has the molecular formula C30H39N3O5 and a molecular weight of 521.66 g/mol. Its IUPAC name is (5R,7S)-3-cycloheptyl-2-N-cyclohexyl-6-N-(3-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5R,7S)-3-cycloheptyl-2-N-cyclohexyl-6-N-(3-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87049200 |
| Molecular Formula | C30H39N3O5 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | (5R,7S)-3-cycloheptyl-2-N-cyclohexyl-6-N-(3-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COc1cccc(NC(=O)C2[C@@H]3C=CC4(O3)C(C(=O)NC3CCCCC3)N(C3CCCCCC3)C(=O)[C@H]24)c1 |
| InChI | InChI=1S/C30H39N3O5/c1-37-22-15-9-12-20(18-22)32-27(34)24-23-16-17-30(38-23)25(24)29(36)33(21-13-7-2-3-8-14-21)26(30)28(35)31-19-10-5-4-6-11-19/h9,12,15-19,21,23-26H,2-8,10-11,13-14H2,1H3,(H,31,35)(H,32,34)/t23-,24?,25-,26?,30?/m0/s1 |
| InChIKey | BHHWIQZAXKPRNR-URBNXYELSA-N |
| XLogP | 3.96 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|