C29H37N3O4S — CID 98181395
(1R,2S,5S,6S,7R)-2-N,3-dicyclohexyl-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98181395) has the molecular formula C29H37N3O4S and a molecular weight of 523.70 g/mol. Its IUPAC name is (1R,2S,5S,6S,7R)-2-N,3-dicyclohexyl-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5S,6S,7R)-2-N,3-dicyclohexyl-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98181395 |
| Molecular Formula | C29H37N3O4S |
| Molecular Weight | 523.70 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | (1R,2S,5S,6S,7R)-2-N,3-dicyclohexyl-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CSc1cccc(NC(=O)[C@@H]2[C@H]3C=C[C@@]4(O3)[C@H]2C(=O)N(C2CCCCC2)[C@@H]4C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C29H37N3O4S/c1-37-21-14-8-11-19(17-21)31-26(33)23-22-15-16-29(36-22)24(23)28(35)32(20-12-6-3-7-13-20)25(29)27(34)30-18-9-4-2-5-10-18/h8,11,14-18,20,22-25H,2-7,9-10,12-13H2,1H3,(H,30,34)(H,31,33)/t22-,23-,24-,25-,29-/m1/s1 |
| InChIKey | AEUSHZFOCOJFAZ-CZKQVMAUSA-N |
| XLogP | 4.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.70 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|