C31H41N3O4S — CID 129436523
(1S,2R,5R,6S,7S)-2-N-cyclohexyl-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129436523) has the molecular formula C31H41N3O4S and a molecular weight of 551.75 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-2-N-cyclohexyl-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7S)-2-N-cyclohexyl-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129436523 |
| Molecular Formula | C31H41N3O4S |
| Molecular Weight | 551.75 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | (1S,2R,5R,6S,7S)-2-N-cyclohexyl-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CSc1cccc(NC(=O)[C@@H]2[C@@H]3C=C[C@]4(O3)[C@@H]2C(=O)N([C@@H]2CCC[C@@H](C)[C@H]2C)[C@H]4C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C31H41N3O4S/c1-18-9-7-14-23(19(18)2)34-27(29(36)32-20-10-5-4-6-11-20)31-16-15-24(38-31)25(26(31)30(34)37)28(35)33-21-12-8-13-22(17-21)39-3/h8,12-13,15-20,23-27H,4-7,9-11,14H2,1-3H3,(H,32,36)(H,33,35)/t18-,19-,23-,24+,25-,26+,27+,31+/m1/s1 |
| InChIKey | PZEQQANACSYKNH-BATHXDGYSA-N |
| XLogP | 4.77 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.75 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|