C31H44N4O4S — CID 98181408
(1S,2R,5R,6R,7S)-2-N-cyclohexyl-3-[2-(dipropylamino)ethyl]-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98181408) has the molecular formula C31H44N4O4S and a molecular weight of 568.78 g/mol. Its IUPAC name is (1S,2R,5R,6R,7S)-2-N-cyclohexyl-3-[2-(dipropylamino)ethyl]-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6R,7S)-2-N-cyclohexyl-3-[2-(dipropylamino)ethyl]-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98181408 |
| Molecular Formula | C31H44N4O4S |
| Molecular Weight | 568.78 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | (1S,2R,5R,6R,7S)-2-N-cyclohexyl-3-[2-(dipropylamino)ethyl]-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCCN(CCC)CCN1C(=O)[C@@H]2[C@@H](C(=O)Nc3cccc(SC)c3)[C@@H]3C=C[C@@]2(O3)[C@@H]1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C31H44N4O4S/c1-4-16-34(17-5-2)18-19-35-27(29(37)32-21-10-7-6-8-11-21)31-15-14-24(39-31)25(26(31)30(35)38)28(36)33-22-12-9-13-23(20-22)40-3/h9,12-15,20-21,24-27H,4-8,10-11,16-19H2,1-3H3,(H,32,37)(H,33,36)/t24-,25-,26-,27-,31-/m0/s1 |
| InChIKey | GIUCWGPOEBKIFQ-IEOQJQNDSA-N |
| XLogP | 4.07 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.78 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|