C34H42N4O4S — CID 99749182
(1R,2R,5S,6S,7R)-3-[3-[benzyl(methyl)amino]propyl]-2-N-cyclohexyl-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99749182) has the molecular formula C34H42N4O4S and a molecular weight of 602.80 g/mol. Its IUPAC name is (1R,2R,5S,6S,7R)-3-[3-[benzyl(methyl)amino]propyl]-2-N-cyclohexyl-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2R,5S,6S,7R)-3-[3-[benzyl(methyl)amino]propyl]-2-N-cyclohexyl-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99749182 |
| Molecular Formula | C34H42N4O4S |
| Molecular Weight | 602.80 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | (1R,2R,5S,6S,7R)-3-[3-[benzyl(methyl)amino]propyl]-2-N-cyclohexyl-6-N-(3-methylsulfanylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CSc1cccc(NC(=O)[C@@H]2[C@H]3C=C[C@]4(O3)[C@H](C(=O)NC3CCCCC3)N(CCCN(C)Cc3ccccc3)C(=O)[C@@H]24)c1 |
| InChI | InChI=1S/C34H42N4O4S/c1-37(22-23-11-5-3-6-12-23)19-10-20-38-30(32(40)35-24-13-7-4-8-14-24)34-18-17-27(42-34)28(29(34)33(38)41)31(39)36-25-15-9-16-26(21-25)43-2/h3,5-6,9,11-12,15-18,21,24,27-30H,4,7-8,10,13-14,19-20,22H2,1-2H3,(H,35,40)(H,36,39)/t27-,28-,29-,30+,34-/m1/s1 |
| InChIKey | XDXPBMSZPZNQBO-CFYNZLEISA-N |
| XLogP | 4.47 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.80 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|