C34H42N4O4 — CID 99750949
(1S,2R,5R,6S,7S)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99750949) has the molecular formula C34H42N4O4 and a molecular weight of 570.73 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7S)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99750949 |
| Molecular Formula | C34H42N4O4 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | (1S,2R,5R,6S,7S)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2[C@@H]3C=C[C@]4(O3)[C@@H]2C(=O)N(CCN(C)Cc2ccccc2)[C@H]4C(=O)NC2CCCCC2)cc1C |
| InChI | InChI=1S/C34H42N4O4/c1-22-14-15-26(20-23(22)2)36-31(39)28-27-16-17-34(42-27)29(28)33(41)38(19-18-37(3)21-24-10-6-4-7-11-24)30(34)32(40)35-25-12-8-5-9-13-25/h4,6-7,10-11,14-17,20,25,27-30H,5,8-9,12-13,18-19,21H2,1-3H3,(H,35,40)(H,36,39)/t27-,28+,29-,30-,34-/m0/s1 |
| InChIKey | XVXHIOFWALNGPC-LQMPARJJSA-N |
| XLogP | 3.97 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|