C38H49N5O4 — CID 99750953
(1S,2R,5R,6S,7S)-3-[3-(4-benzylpiperazin-1-yl)propyl]-2-N-cyclohexyl-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99750953) has the molecular formula C38H49N5O4 and a molecular weight of 639.84 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-3-[3-(4-benzylpiperazin-1-yl)propyl]-2-N-cyclohexyl-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7S)-3-[3-(4-benzylpiperazin-1-yl)propyl]-2-N-cyclohexyl-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99750953 |
| Molecular Formula | C38H49N5O4 |
| Molecular Weight | 639.84 g/mol |
| Exact Mass | 639.38 |
| IUPAC Name | (1S,2R,5R,6S,7S)-3-[3-(4-benzylpiperazin-1-yl)propyl]-2-N-cyclohexyl-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2[C@@H]3C=C[C@]4(O3)[C@@H]2C(=O)N(CCCN2CCN(Cc3ccccc3)CC2)[C@H]4C(=O)NC2CCCCC2)cc1C |
| InChI | InChI=1S/C38H49N5O4/c1-26-14-15-30(24-27(26)2)40-35(44)32-31-16-17-38(47-31)33(32)37(46)43(34(38)36(45)39-29-12-7-4-8-13-29)19-9-18-41-20-22-42(23-21-41)25-28-10-5-3-6-11-28/h3,5-6,10-11,14-17,24,29,31-34H,4,7-9,12-13,18-23,25H2,1-2H3,(H,39,45)(H,40,44)/t31-,32+,33-,34-,38-/m0/s1 |
| InChIKey | DWNFDPCMMSUEDF-GHVGUZTBSA-N |
| XLogP | 4.05 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.84 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|