C30H41N3O5 — CID 98181188
(1R,2S,5S,6R,7R)-2-N-cyclohexyl-6-N-(3,4-dimethylphenyl)-4-oxo-3-(3-propan-2-yloxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98181188) has the molecular formula C30H41N3O5 and a molecular weight of 523.67 g/mol. Its IUPAC name is (1R,2S,5S,6R,7R)-2-N-cyclohexyl-6-N-(3,4-dimethylphenyl)-4-oxo-3-(3-propan-2-yloxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5S,6R,7R)-2-N-cyclohexyl-6-N-(3,4-dimethylphenyl)-4-oxo-3-(3-propan-2-yloxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98181188 |
| Molecular Formula | C30H41N3O5 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.30 |
| IUPAC Name | (1R,2S,5S,6R,7R)-2-N-cyclohexyl-6-N-(3,4-dimethylphenyl)-4-oxo-3-(3-propan-2-yloxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2[C@H]3C=C[C@@]4(O3)[C@H]2C(=O)N(CCCOC(C)C)[C@@H]4C(=O)NC2CCCCC2)cc1C |
| InChI | InChI=1S/C30H41N3O5/c1-18(2)37-16-8-15-33-26(28(35)31-21-9-6-5-7-10-21)30-14-13-23(38-30)24(25(30)29(33)36)27(34)32-22-12-11-19(3)20(4)17-22/h11-14,17-18,21,23-26H,5-10,15-16H2,1-4H3,(H,31,35)(H,32,34)/t23-,24+,25-,26-,30-/m1/s1 |
| InChIKey | FGJPJCQIWCHYRG-QKSWYADASA-N |
| XLogP | 3.66 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|