C28H35Cl2N3O5 — CID 46503911
2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-4-oxo-3-(3-propan-2-yloxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 46503911) has the molecular formula C28H35Cl2N3O5 and a molecular weight of 564.51 g/mol. Its IUPAC name is 2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-4-oxo-3-(3-propan-2-yloxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | 2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-4-oxo-3-(3-propan-2-yloxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 46503911 |
| Molecular Formula | C28H35Cl2N3O5 |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | 2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-4-oxo-3-(3-propan-2-yloxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC(C)OCCCN1C(=O)C2C(C(=O)Nc3cc(Cl)cc(Cl)c3)C3C=CC2(O3)C1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C28H35Cl2N3O5/c1-16(2)37-12-6-11-33-24(26(35)31-19-7-4-3-5-8-19)28-10-9-21(38-28)22(23(28)27(33)36)25(34)32-20-14-17(29)13-18(30)15-20/h9-10,13-16,19,21-24H,3-8,11-12H2,1-2H3,(H,31,35)(H,32,34) |
| InChIKey | RPAGPJVDJAZWNY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|