C30H39Cl2N5O4 — CID 87049157
(5S,7R)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-[2-(4-ethylpiperazin-1-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87049157) has the molecular formula C30H39Cl2N5O4 and a molecular weight of 604.58 g/mol. Its IUPAC name is (5S,7R)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-[2-(4-ethylpiperazin-1-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5S,7R)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-[2-(4-ethylpiperazin-1-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87049157 |
| Molecular Formula | C30H39Cl2N5O4 |
| Molecular Weight | 604.58 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | (5S,7R)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-[2-(4-ethylpiperazin-1-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCN1CCN(CCN2C(=O)[C@H]3C(C(=O)Nc4cc(Cl)cc(Cl)c4)[C@H]4C=CC3(O4)C2C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C30H39Cl2N5O4/c1-2-35-10-12-36(13-11-35)14-15-37-26(28(39)33-21-6-4-3-5-7-21)30-9-8-23(41-30)24(25(30)29(37)40)27(38)34-22-17-19(31)16-20(32)18-22/h8-9,16-18,21,23-26H,2-7,10-15H2,1H3,(H,33,39)(H,34,38)/t23-,24?,25-,26?,30?/m1/s1 |
| InChIKey | HMVIGEPJFCBGAK-DOEILYTDSA-N |
| XLogP | 3.17 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|