C30H40N4O5 — CID 99753283
(1R,2R,5S,6S,7R)-2-N-cyclohexyl-6-N-(3,5-dimethylphenyl)-3-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99753283) has the molecular formula C30H40N4O5 and a molecular weight of 536.67 g/mol. Its IUPAC name is (1R,2R,5S,6S,7R)-2-N-cyclohexyl-6-N-(3,5-dimethylphenyl)-3-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2R,5S,6S,7R)-2-N-cyclohexyl-6-N-(3,5-dimethylphenyl)-3-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99753283 |
| Molecular Formula | C30H40N4O5 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | (1R,2R,5S,6S,7R)-2-N-cyclohexyl-6-N-(3,5-dimethylphenyl)-3-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)[C@@H]2[C@H]3C=C[C@]4(O3)[C@H](C(=O)NC3CCCCC3)N(CCN3CCOCC3)C(=O)[C@@H]24)c1 |
| InChI | InChI=1S/C30H40N4O5/c1-19-16-20(2)18-22(17-19)32-27(35)24-23-8-9-30(39-23)25(24)29(37)34(11-10-33-12-14-38-15-13-33)26(30)28(36)31-21-6-4-3-5-7-21/h8-9,16-18,21,23-26H,3-7,10-15H2,1-2H3,(H,31,36)(H,32,35)/t23-,24-,25-,26+,30-/m1/s1 |
| InChIKey | VXPLDKYORFKSOD-MNTJOYDJSA-N |
| XLogP | 2.17 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|