C29H36Cl2N4O5 — CID 98179970
(1S,2S,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-3-(3-morpholin-4-ylpropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98179970) has the molecular formula C29H36Cl2N4O5 and a molecular weight of 591.54 g/mol. Its IUPAC name is (1S,2S,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-3-(3-morpholin-4-ylpropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2S,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-3-(3-morpholin-4-ylpropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98179970 |
| Molecular Formula | C29H36Cl2N4O5 |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | (1S,2S,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-3-(3-morpholin-4-ylpropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)[C@H]1[C@@H]2C=C[C@]3(O2)[C@@H]1C(=O)N(CCCN1CCOCC1)[C@@H]3C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C29H36Cl2N4O5/c30-20-8-7-19(17-21(20)31)33-26(36)23-22-9-10-29(40-22)24(23)28(38)35(12-4-11-34-13-15-39-16-14-34)25(29)27(37)32-18-5-2-1-3-6-18/h7-10,17-18,22-25H,1-6,11-16H2,(H,32,37)(H,33,36)/t22-,23-,24-,25+,29-/m0/s1 |
| InChIKey | LVZUXHVTGWQEOF-YHBIVLTJSA-N |
| XLogP | 3.25 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|