C30H39ClN4O4 — CID 98180382
(1S,2S,5R,6S,7S)-6-N-(3-chlorophenyl)-2-N-cyclohexyl-4-oxo-3-(3-piperidin-1-ylpropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98180382) has the molecular formula C30H39ClN4O4 and a molecular weight of 555.12 g/mol. Its IUPAC name is (1S,2S,5R,6S,7S)-6-N-(3-chlorophenyl)-2-N-cyclohexyl-4-oxo-3-(3-piperidin-1-ylpropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2S,5R,6S,7S)-6-N-(3-chlorophenyl)-2-N-cyclohexyl-4-oxo-3-(3-piperidin-1-ylpropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98180382 |
| Molecular Formula | C30H39ClN4O4 |
| Molecular Weight | 555.12 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | (1S,2S,5R,6S,7S)-6-N-(3-chlorophenyl)-2-N-cyclohexyl-4-oxo-3-(3-piperidin-1-ylpropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)[C@@H]1[C@@H]2C=C[C@]3(O2)[C@@H]1C(=O)N(CCCN1CCCCC1)[C@@H]3C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C30H39ClN4O4/c31-20-9-7-12-22(19-20)33-27(36)24-23-13-14-30(39-23)25(24)29(38)35(18-8-17-34-15-5-2-6-16-34)26(30)28(37)32-21-10-3-1-4-11-21/h7,9,12-14,19,21,23-26H,1-6,8,10-11,15-18H2,(H,32,37)(H,33,36)/t23-,24+,25-,26+,30-/m0/s1 |
| InChIKey | VNNHQAPDLJYJND-CDQOISDYSA-N |
| XLogP | 3.75 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.12 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|