C32H43ClN4O4 — CID 99751672
(1S,2R,5R,6R,7S)-6-N-(3-chlorophenyl)-2-N-cyclohexyl-3-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99751672) has the molecular formula C32H43ClN4O4 and a molecular weight of 583.17 g/mol. Its IUPAC name is (1S,2R,5R,6R,7S)-6-N-(3-chlorophenyl)-2-N-cyclohexyl-3-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6R,7S)-6-N-(3-chlorophenyl)-2-N-cyclohexyl-3-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99751672 |
| Molecular Formula | C32H43ClN4O4 |
| Molecular Weight | 583.17 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | (1S,2R,5R,6R,7S)-6-N-(3-chlorophenyl)-2-N-cyclohexyl-3-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC[C@@H]1CCCCN1CCCN1C(=O)[C@@H]2[C@@H](C(=O)Nc3cccc(Cl)c3)[C@@H]3C=C[C@@]2(O3)[C@@H]1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C32H43ClN4O4/c1-2-24-14-6-7-17-36(24)18-9-19-37-28(30(39)34-22-11-4-3-5-12-22)32-16-15-25(41-32)26(27(32)31(37)40)29(38)35-23-13-8-10-21(33)20-23/h8,10,13,15-16,20,22,24-28H,2-7,9,11-12,14,17-19H2,1H3,(H,34,39)(H,35,38)/t24-,25+,26+,27+,28+,32+/m1/s1 |
| InChIKey | VFHOANXEQUFPNH-FYHPCBKWSA-N |
| XLogP | 4.53 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.17 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|