C29H37ClN4O4 — CID 99751707
(1S,2R,5R,6R,7S)-6-N-(3-chlorophenyl)-2-N-cyclohexyl-4-oxo-3-(2-piperidin-1-ylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99751707) has the molecular formula C29H37ClN4O4 and a molecular weight of 541.09 g/mol. Its IUPAC name is (1S,2R,5R,6R,7S)-6-N-(3-chlorophenyl)-2-N-cyclohexyl-4-oxo-3-(2-piperidin-1-ylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6R,7S)-6-N-(3-chlorophenyl)-2-N-cyclohexyl-4-oxo-3-(2-piperidin-1-ylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99751707 |
| Molecular Formula | C29H37ClN4O4 |
| Molecular Weight | 541.09 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | (1S,2R,5R,6R,7S)-6-N-(3-chlorophenyl)-2-N-cyclohexyl-4-oxo-3-(2-piperidin-1-ylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)[C@H]1[C@@H]2C=C[C@]3(O2)[C@@H]1C(=O)N(CCN1CCCCC1)[C@H]3C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C29H37ClN4O4/c30-19-8-7-11-21(18-19)32-26(35)23-22-12-13-29(38-22)24(23)28(37)34(17-16-33-14-5-2-6-15-33)25(29)27(36)31-20-9-3-1-4-10-20/h7-8,11-13,18,20,22-25H,1-6,9-10,14-17H2,(H,31,36)(H,32,35)/t22-,23-,24-,25-,29-/m0/s1 |
| InChIKey | HQJFJOMIRKJSCU-GLXJOHRYSA-N |
| XLogP | 3.36 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.09 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|