C30H40N4O5 — CID 177212413
(1S,5R,6R,7R)-3-[2-(azepan-1-yl)ethyl]-2-N-cyclohexyl-6-N-(4-hydroxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 177212413) has the molecular formula C30H40N4O5 and a molecular weight of 536.67 g/mol. Its IUPAC name is (1S,5R,6R,7R)-3-[2-(azepan-1-yl)ethyl]-2-N-cyclohexyl-6-N-(4-hydroxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,5R,6R,7R)-3-[2-(azepan-1-yl)ethyl]-2-N-cyclohexyl-6-N-(4-hydroxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 177212413 |
| Molecular Formula | C30H40N4O5 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | (1S,5R,6R,7R)-3-[2-(azepan-1-yl)ethyl]-2-N-cyclohexyl-6-N-(4-hydroxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | O=C(NC1CCCCC1)C1N(CCN2CCCCCC2)C(=O)[C@@H]2[C@@H](C(=O)Nc3ccc(O)cc3)[C@H]3C=C[C@@]12O3 |
| InChI | InChI=1S/C30H40N4O5/c35-22-12-10-21(11-13-22)31-27(36)24-23-14-15-30(39-23)25(24)29(38)34(19-18-33-16-6-1-2-7-17-33)26(30)28(37)32-20-8-4-3-5-9-20/h10-15,20,23-26,35H,1-9,16-19H2,(H,31,36)(H,32,37)/t23-,24+,25+,26?,30+/m1/s1 |
| InChIKey | XXOMRXXDZNLGGN-GFBVTLCESA-N |
| XLogP | 2.81 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|