C36H44N4O5 — CID 99753222
(1R,2R,5S,6S,7R)-3-[2-(azepan-1-yl)ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99753222) has the molecular formula C36H44N4O5 and a molecular weight of 612.77 g/mol. Its IUPAC name is (1R,2R,5S,6S,7R)-3-[2-(azepan-1-yl)ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2R,5S,6S,7R)-3-[2-(azepan-1-yl)ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99753222 |
| Molecular Formula | C36H44N4O5 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.33 |
| IUPAC Name | (1R,2R,5S,6S,7R)-3-[2-(azepan-1-yl)ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)[C@@H]1[C@H]2C=C[C@]3(O2)[C@H](C(=O)NC2CCCCC2)N(CCN2CCCCCC2)C(=O)[C@@H]13 |
| InChI | InChI=1S/C36H44N4O5/c41-33(37-26-15-17-28(18-16-26)44-27-13-7-4-8-14-27)30-29-19-20-36(45-29)31(30)35(43)40(24-23-39-21-9-1-2-10-22-39)32(36)34(42)38-25-11-5-3-6-12-25/h4,7-8,13-20,25,29-32H,1-3,5-6,9-12,21-24H2,(H,37,41)(H,38,42)/t29-,30-,31-,32+,36-/m1/s1 |
| InChIKey | ZMIWEUNEKDAFCW-UWKUDSDFSA-N |
| XLogP | 4.89 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|