C36H41N3O5 — CID 99753123
(1R,2R,5S,6S,7R)-3-[2-(cyclohexen-1-yl)ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99753123) has the molecular formula C36H41N3O5 and a molecular weight of 595.74 g/mol. Its IUPAC name is (1R,2R,5S,6S,7R)-3-[2-(cyclohexen-1-yl)ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2R,5S,6S,7R)-3-[2-(cyclohexen-1-yl)ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99753123 |
| Molecular Formula | C36H41N3O5 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | (1R,2R,5S,6S,7R)-3-[2-(cyclohexen-1-yl)ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)[C@@H]1[C@H]2C=C[C@]3(O2)[C@H](C(=O)NC2CCCCC2)N(CCC2=CCCCC2)C(=O)[C@@H]13 |
| InChI | InChI=1S/C36H41N3O5/c40-33(37-26-16-18-28(19-17-26)43-27-14-8-3-9-15-27)30-29-20-22-36(44-29)31(30)35(42)39(23-21-24-10-4-1-5-11-24)32(36)34(41)38-25-12-6-2-7-13-25/h3,8-10,14-20,22,25,29-32H,1-2,4-7,11-13,21,23H2,(H,37,40)(H,38,41)/t29-,30-,31-,32+,36-/m1/s1 |
| InChIKey | MVGYVOIRKFKZDW-UWKUDSDFSA-N |
| XLogP | 5.91 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|