C35H42N4O5 — CID 99753251
(1R,2R,5S,6R,7R)-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-3-(2-piperidin-1-ylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99753251) has the molecular formula C35H42N4O5 and a molecular weight of 598.74 g/mol. Its IUPAC name is (1R,2R,5S,6R,7R)-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-3-(2-piperidin-1-ylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2R,5S,6R,7R)-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-3-(2-piperidin-1-ylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99753251 |
| Molecular Formula | C35H42N4O5 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | (1R,2R,5S,6R,7R)-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-3-(2-piperidin-1-ylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)[C@H]1[C@H]2C=C[C@]3(O2)[C@H](C(=O)NC2CCCCC2)N(CCN2CCCCC2)C(=O)[C@@H]13 |
| InChI | InChI=1S/C35H42N4O5/c40-32(36-25-14-16-27(17-15-25)43-26-12-6-2-7-13-26)29-28-18-19-35(44-28)30(29)34(42)39(23-22-38-20-8-3-9-21-38)31(35)33(41)37-24-10-4-1-5-11-24/h2,6-7,12-19,24,28-31H,1,3-5,8-11,20-23H2,(H,36,40)(H,37,41)/t28-,29+,30-,31+,35-/m1/s1 |
| InChIKey | NRSCUTURPXUFIB-UICYFZHZSA-N |
| XLogP | 4.50 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|