C36H45N5O5 — CID 100617471
(1S,2R,5S,6S,7R)-2-N-cyclohexyl-3-[2-(4-ethylpiperazin-1-yl)ethyl]-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 100617471) has the molecular formula C36H45N5O5 and a molecular weight of 627.79 g/mol. Its IUPAC name is (1S,2R,5S,6S,7R)-2-N-cyclohexyl-3-[2-(4-ethylpiperazin-1-yl)ethyl]-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5S,6S,7R)-2-N-cyclohexyl-3-[2-(4-ethylpiperazin-1-yl)ethyl]-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 100617471 |
| Molecular Formula | C36H45N5O5 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.34 |
| IUPAC Name | (1S,2R,5S,6S,7R)-2-N-cyclohexyl-3-[2-(4-ethylpiperazin-1-yl)ethyl]-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCN1CCN(CCN2C(=O)[C@H]3[C@H](C(=O)Nc4ccc(Oc5ccccc5)cc4)[C@H]4C=C[C@@]3(O4)[C@@H]2C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C36H45N5O5/c1-2-39-19-21-40(22-20-39)23-24-41-32(34(43)38-25-9-5-3-6-10-25)36-18-17-29(46-36)30(31(36)35(41)44)33(42)37-26-13-15-28(16-14-26)45-27-11-7-4-8-12-27/h4,7-8,11-18,25,29-32H,2-3,5-6,9-10,19-24H2,1H3,(H,37,42)(H,38,43)/t29-,30-,31-,32+,36+/m1/s1 |
| InChIKey | FSSDOOXNORRSON-RNBBJCFKSA-N |
| XLogP | 3.65 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|