C36H46N4O5 — CID 98180824
(1S,2R,5S,6R,7R)-2-N-cyclohexyl-3-[2-(dipropylamino)ethyl]-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98180824) has the molecular formula C36H46N4O5 and a molecular weight of 614.79 g/mol. Its IUPAC name is (1S,2R,5S,6R,7R)-2-N-cyclohexyl-3-[2-(dipropylamino)ethyl]-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5S,6R,7R)-2-N-cyclohexyl-3-[2-(dipropylamino)ethyl]-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98180824 |
| Molecular Formula | C36H46N4O5 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.35 |
| IUPAC Name | (1S,2R,5S,6R,7R)-2-N-cyclohexyl-3-[2-(dipropylamino)ethyl]-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCCN(CCC)CCN1C(=O)[C@H]2[C@@H](C(=O)Nc3ccc(Oc4ccccc4)cc3)[C@H]3C=C[C@@]2(O3)[C@@H]1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C36H46N4O5/c1-3-21-39(22-4-2)23-24-40-32(34(42)38-25-11-7-5-8-12-25)36-20-19-29(45-36)30(31(36)35(40)43)33(41)37-26-15-17-28(18-16-26)44-27-13-9-6-10-14-27/h6,9-10,13-20,25,29-32H,3-5,7-8,11-12,21-24H2,1-2H3,(H,37,41)(H,38,42)/t29-,30+,31-,32+,36+/m1/s1 |
| InChIKey | VDXHCKMKWHECCU-PWRLTIQESA-N |
| XLogP | 5.14 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|