C33H40N4O5 — CID 98180301
(1S,2R,5R,6R,7S)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-6-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98180301) has the molecular formula C33H40N4O5 and a molecular weight of 572.71 g/mol. Its IUPAC name is (1S,2R,5R,6R,7S)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-6-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6R,7S)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-6-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98180301 |
| Molecular Formula | C33H40N4O5 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | (1S,2R,5R,6R,7S)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-6-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COc1ccc(NC(=O)[C@H]2[C@@H]3C=C[C@]4(O3)[C@@H]2C(=O)N(CCN(C)Cc2ccccc2)[C@H]4C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C33H40N4O5/c1-36(21-22-9-5-3-6-10-22)19-20-37-29(31(39)35-23-11-7-4-8-12-23)33-18-17-26(42-33)27(28(33)32(37)40)30(38)34-24-13-15-25(41-2)16-14-24/h3,5-6,9-10,13-18,23,26-29H,4,7-8,11-12,19-21H2,1-2H3,(H,34,38)(H,35,39)/t26-,27-,28-,29-,33-/m0/s1 |
| InChIKey | JUXGBGMPQWLDDS-WMCQFGFVSA-N |
| XLogP | 3.37 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|