C32H36Cl2N4O4 — CID 87049151
(5R,7S)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87049151) has the molecular formula C32H36Cl2N4O4 and a molecular weight of 611.57 g/mol. Its IUPAC name is (5R,7S)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5R,7S)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87049151 |
| Molecular Formula | C32H36Cl2N4O4 |
| Molecular Weight | 611.57 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | (5R,7S)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CN(CCN1C(=O)[C@@H]2C(C(=O)Nc3cc(Cl)cc(Cl)c3)[C@@H]3C=CC2(O3)C1C(=O)NC1CCCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C32H36Cl2N4O4/c1-37(19-20-8-4-2-5-9-20)14-15-38-28(30(40)35-23-10-6-3-7-11-23)32-13-12-25(42-32)26(27(32)31(38)41)29(39)36-24-17-21(33)16-22(34)18-24/h2,4-5,8-9,12-13,16-18,23,25-28H,3,6-7,10-11,14-15,19H2,1H3,(H,35,40)(H,36,39)/t25-,26?,27-,28?,32?/m0/s1 |
| InChIKey | KVGIOUJTBSLWDL-LMZIJACBSA-N |
| XLogP | 4.66 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|