C28H36Cl2N4O4 — CID 171713694
(1R,5S,6R,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-[2-(diethylamino)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 171713694) has the molecular formula C28H36Cl2N4O4 and a molecular weight of 563.53 g/mol. Its IUPAC name is (1R,5S,6R,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-[2-(diethylamino)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,5S,6R,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-[2-(diethylamino)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 171713694 |
| Molecular Formula | C28H36Cl2N4O4 |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | (1R,5S,6R,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-[2-(diethylamino)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCN(CC)CCN1C(=O)[C@H]2[C@@H](C(=O)Nc3cc(Cl)cc(Cl)c3)[C@@H]3C=C[C@]2(O3)C1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C28H36Cl2N4O4/c1-3-33(4-2)12-13-34-24(26(36)31-19-8-6-5-7-9-19)28-11-10-21(38-28)22(23(28)27(34)37)25(35)32-20-15-17(29)14-18(30)16-20/h10-11,14-16,19,21-24H,3-9,12-13H2,1-2H3,(H,31,36)(H,32,35)/t21-,22-,23+,24?,28+/m0/s1 |
| InChIKey | JZSQCOQIDGLTLK-RMMBVEHESA-N |
| XLogP | 3.87 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|